CAS 951173-27-6
:(1S,2S)-2-Aminocyclobutanecarboxylic acid
Description:
(1S,2S)-2-Aminocyclobutanecarboxylic acid, with the CAS number 951173-27-6, is a cyclic amino acid characterized by its four-membered cyclobutane ring structure. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the cyclobutane, which contributes to its classification as an amino acid. The specific stereochemistry indicated by (1S,2S) denotes the spatial arrangement of the substituents around the chiral centers, which can significantly influence the compound's biological activity and interactions. This amino acid is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential role in peptide synthesis and as a building block for more complex molecules. Its unique structure may also impart distinct properties, such as solubility and reactivity, compared to more common amino acids. Overall, (1S,2S)-2-Aminocyclobutanecarboxylic acid represents a fascinating subject for research, particularly in the context of drug design and development.
Formula:C5H9NO2
InChI:InChI=1S/C5H9NO2/c6-4-2-1-3(4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4-/m0/s1
InChI key:InChIKey=NSQMWZLLTGEDQU-IMJSIDKUSA-N
SMILES:C(O)(=O)[C@@H]1[C@@H](N)CC1
Synonyms:- (1S,2S)-2-Aminocyclobutanecarboxylic acid
- Cyclobutanecarboxylic acid, 2-amino-, (1S,2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.