CAS 951174-11-1
:tert-Butyl 4-(5-methoxy-1H-indol-3-yl)-1-piperidinecarboxylate
Description:
Tert-Butyl 4-(5-methoxy-1H-indol-3-yl)-1-piperidinecarboxylate, with the CAS number 951174-11-1, is a chemical compound characterized by its complex structure, which includes a tert-butyl group, an indole moiety, and a piperidine ring. This compound typically exhibits properties associated with both indole and piperidine derivatives, such as potential biological activity and solubility in organic solvents. The presence of the methoxy group on the indole ring may influence its electronic properties and reactivity, potentially enhancing its lipophilicity. The tert-butyl ester functionality suggests that it may be stable under various conditions, while also being amenable to hydrolysis under acidic or basic conditions. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including interactions with biological targets. Overall, this compound's unique structural features may contribute to its utility in research and development within the fields of pharmaceuticals and organic synthesis.
Formula:C19H26N2O3
InChI:InChI=1/C19H26N2O3/c1-19(2,3)24-18(22)21-9-7-13(8-10-21)16-12-20-17-6-5-14(23-4)11-15(16)17/h5-6,11-13,20H,7-10H2,1-4H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)c1c[nH]c2ccc(cc12)OC
Synonyms:- 4-(5-Methoxy-1H-indol-3-yl)-1-piperidinecarboxylic acid 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-(5-methoxy-1H-indol-3-yl)piperidine-1-carboxylate
CAS:Formula:C19H26N2O3Color and Shape:SolidMolecular weight:330.4213

