
CAS 951174-48-4
:(βR)-β-Amino[1,1′-biphenyl]-4-propanoic acid
Description:
(βR)-β-Amino[1,1′-biphenyl]-4-propanoic acid, identified by its CAS number 951174-48-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a β-amino acid structure, incorporating an amino group (-NH2) and a propanoic acid moiety, which contributes to its potential biological activity. The presence of the chiral βR configuration indicates that it exists as a specific enantiomer, which can influence its pharmacological properties and interactions in biological systems. Typically, compounds like this may exhibit properties such as solubility in polar solvents, and they may participate in hydrogen bonding due to the amino and carboxylic acid functional groups. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties, including its stability, reactivity, and biological effects.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c16-14(10-15(17)18)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9,14H,10,16H2,(H,17,18)/t14-/m1/s1
InChI key:InChIKey=BJZGTTDEOZUSRH-CQSZACIVSA-N
SMILES:[C@H](CC(O)=O)(N)C1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:- [1,1′-Biphenyl]-4-propanoic acid, β-amino-, (βR)-
- (3R)-3-Amino-3-(4-phenylphenyl)propanoic acid
- (βR)-β-Amino[1,1′-biphenyl]-4-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.