CAS 95130-23-7
:1H-inden-1-one, 3-(cyclohexylamino)-2,3-dihydro-2-(phenylmethylene)-, chloride
Description:
1H-Inden-1-one, 3-(cyclohexylamino)-2,3-dihydro-2-(phenylmethylene)-, chloride, with the CAS number 95130-23-7, is a chemical compound that features a complex structure incorporating an indene moiety, an amine group, and a phenylmethylene substituent. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the cyclohexylamino and phenylmethylene groups. The chloride component suggests that it may exist as a salt or may be involved in ionic interactions. In terms of physical properties, it is likely to be a solid at room temperature, with solubility influenced by the presence of the chloride ion and the overall hydrophobic character of the cyclohexyl and phenyl groups. The compound may exhibit interesting reactivity due to the presence of the carbonyl group in the indenone structure, making it a candidate for further studies in medicinal chemistry or organic synthesis. However, specific data on its toxicity, stability, and reactivity would require further investigation.
Formula:C22H24ClNO
InChI:InChI=1/C22H23NO.ClH/c24-22-19-14-8-7-13-18(19)21(23-17-11-5-2-6-12-17)20(22)15-16-9-3-1-4-10-16;/h1,3-4,7-10,13-15,17,21,23H,2,5-6,11-12H2;1H/p-1
SMILES:c1ccc(cc1)C=C1C(c2ccccc2C1=O)NC1CCCCC1.[Cl-]
Synonyms:- NSC 150117 hydrochloride
- BCI hydrochloride - NSC 150117 hydrochloride
- BCI (hydrochloride)
- 2-benzylidene-3-(cyclohexylamino)-1-Indanone hydrochloride
- (E)-2-benzylidene-3-(cyclohexylamino)-2,3-dihydro-1H-inden-1-one
- 3-(cyclohexylamino)-2,3-dihydro-2-(phenylmethylene)-1Hinden-1-one
- (E)-BCI hydrochloride
- (E/Z)-BCI
- (E/Z)-BCI hydrochloride
- (2Z)-2-benzylidene-3-(cyclohexylamino)-3H-inden-1-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(E/Z)-BCI hydrochloride
CAS:Formula:C22H23NO·HClPurity:≥ 98.0%Color and Shape:White or off-white powderMolecular weight:353.89BCI hydrochloride
CAS:BCI hydrochloride ((E)-BCI hydrochloride) is a DUSP6 inhibitor that inhibits RANKL-mediated osteoclastogenesis and attenuates oophorectomy-induced bone loss.Formula:C22H24ClNOPurity:99.95%Color and Shape:SolidMolecular weight:353.89


