CAS 951380-42-0
:5-[2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2(3H)-one
Description:
The chemical substance known as 5-[2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2(3H)-one, with the CAS number 951380-42-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a thieno[3,2-c]pyridinone core. This compound features a cyclopropyl group and a fluorophenyl moiety, contributing to its unique chemical properties and potential biological activity. The presence of the ketone functional group and the tetrahydrothieno ring system suggests that it may exhibit interesting reactivity and pharmacological profiles. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The specific interactions and mechanisms of action would depend on its molecular conformation and the presence of substituents, which can influence its binding affinity to biological targets. Overall, this compound represents a class of heterocyclic compounds that may have significant implications in pharmaceutical research.
Formula:C18H18FNO2S
InChI:InChI=1/C18H18FNO2S/c19-14-4-2-1-3-13(14)17(18(22)11-5-6-11)20-8-7-15-12(10-20)9-16(21)23-15/h1-4,11,17H,5-10H2
SMILES:c1ccc(c(c1)C(C(=O)C1CC1)N1CCC2=C(CC(=O)S2)C1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-P-3952
Discontinued product

