CAS 951624-95-6

1-[4-(Ethylsulfonyl)-2-nitrophenyl]-4-piperidinecarboxylic acid

Description:

1-[4-(Ethylsulfonyl)-2-nitrophenyl]-4-piperidinecarboxylic acid, with the CAS number 951624-95-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a carboxylic acid functional group, and a nitrophenyl moiety substituted with an ethylsulfonyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the sulfonyl and nitro groups may influence its reactivity and polarity. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored in medicinal chemistry for their pharmacological properties. Additionally, the nitro group can serve as a site for further chemical modifications, making this compound of interest in synthetic organic chemistry. Overall, its unique structural features may contribute to its potential applications in pharmaceuticals or as a research tool in various chemical studies.

Formula: C₁₄H₁₈N₂O₆S

InChI: InChI=1S/C14H18N2O6S/c1-2-23(21,22)11-3-4-12(13(9-11)16(19)20)15-7-5-10(6-8-15)14(17)18/h3-4,9-10H,2,5-8H2,1H3,(H,17,18)

InChI key: InChIKey=FGIGIBBLTMASSN-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=CC(S(CC)(=O)=O)=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[4-(ethylsulfonyl)-2-nitrophenyl]-
• 1-[4-(Ethylsulfonyl)-2-nitrophenyl]-4-piperidinecarboxylic acid

1-[4-(Ethylsulphonyl)-2-nitrophenyl]piperidine-4-carboxylic acid

CAS: 951624-95-6

1-[4-(Ethylsulphonyl)-2-nitrophenyl]piperidine-4-carboxylic acid

Purity: ≥95%

Ref: 54-OR8365