CAS 951625-11-9

2,5-Bis(trifluoromethyl)benzenesulfonamide

Description:

2,5-Bis(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that has two trifluoromethyl groups at the 2 and 5 positions. This structure contributes to its unique properties, including high lipophilicity and potential biological activity. The trifluoromethyl groups enhance the compound's electron-withdrawing characteristics, which can influence its reactivity and interactions with biological targets. The sulfonamide moiety is known for its role in pharmaceuticals, often contributing to antibacterial and diuretic activities. This compound is typically solid at room temperature and may exhibit stability under various conditions, although it should be handled with care due to the presence of fluorinated groups, which can impart toxicity and environmental persistence. Its applications may extend to medicinal chemistry, agrochemicals, or materials science, depending on its specific reactivity and interactions. As with any chemical, proper safety protocols should be followed when handling this substance.

Formula: C₈H₅F₆NO₂S

InChI: InChI=1S/C8H5F6NO2S/c9-7(10,11)4-1-2-5(8(12,13)14)6(3-4)18(15,16)17/h1-3H,(H2,15,16,17)

InChI key: InChIKey=KQNPHVUXUGXXCV-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(C(F)(F)F)C=CC(C(F)(F)F)=C1

Synonyms:

• Benzenesulfonamide, 2,5-bis(trifluoromethyl)-
• 2,5-Bis(trifluoromethyl)benzenesulfonamide