CAS 951625-96-0
:4-[(1,1-Dimethylethoxy)methyl]tetrahydro-2H-pyran-4-amine
Description:
4-[(1,1-Dimethylethoxy)methyl]tetrahydro-2H-pyran-4-amine, identified by its CAS number 951625-96-0, is a chemical compound characterized by its unique structural features. It contains a tetrahydropyran ring, which is a six-membered cyclic ether with five carbon atoms and one oxygen atom, contributing to its stability and reactivity. The presence of an amine functional group indicates that it can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications. The 1,1-dimethylethoxy group adds steric bulk, which can influence the compound's solubility and reactivity. This compound may exhibit properties typical of amines, such as basicity and nucleophilicity, and could be of interest in medicinal chemistry or as an intermediate in organic synthesis. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed due to potential reactivity.
Formula:C10H21NO2
InChI:InChI=1S/C10H21NO2/c1-9(2,3)13-8-10(11)4-6-12-7-5-10/h4-8,11H2,1-3H3
InChI key:InChIKey=FXLAEAXJZOUZNJ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)C1(N)CCOCC1
Synonyms:- 2H-Pyran-4-amine, 4-[(1,1-dimethylethoxy)methyl]tetrahydro-
- 2H-pyran-4-amine, 4-[(1,1-dimethylethoxy)methyl]tetrahydro-
- 4-[(1,1-Dimethylethoxy)methyl]tetrahydro-2H-pyran-4-amine
- 4-tert-Butoxymethyl-tetrahydro-pyran-4-ylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
