CAS 951625-97-1
:4-(1,1-Dimethylethoxy)cyclohexanamine
Description:
4-(1,1-Dimethylethoxy)cyclohexanamine is an organic compound characterized by its cyclohexane ring structure substituted with an amine group and a tert-butoxy group. This compound features a cyclohexane backbone, which contributes to its cyclic structure and potential conformational flexibility. The presence of the amine group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The tert-butoxy substituent, derived from 1,1-dimethylethyl alcohol, adds steric bulk, which can affect the compound's interactions with other molecules and its overall stability. This compound may exhibit properties typical of amines, such as basicity and nucleophilicity, making it potentially useful in various chemical reactions or as an intermediate in organic synthesis. Its specific applications and behavior would depend on the context of its use, including potential roles in pharmaceuticals or materials science. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C10H21NO
InChI:InChI=1S/C10H21NO/c1-10(2,3)12-9-6-4-8(11)5-7-9/h8-9H,4-7,11H2,1-3H3
InChI key:InChIKey=IJCTXLVZPMAIJS-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1CCC(N)CC1
Synonyms:- 4-(1,1-Dimethylethoxy)cyclohexanamine
- 4-Tert-butoxycyclohexanamine
- Cyclohexanamine, 4-(1,1-Dimethylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
