CAS 951626-63-4

6-tert-butyl-1H-pyrazolo[3,4-b]pyridin-3-amine

Description:

6-tert-butyl-1H-pyrazolo[3,4-b]pyridin-3-amine is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates a tert-butyl group at the 6-position and an amino group at the 3-position of the pyrazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. Its molecular structure suggests that it may interact with biological targets, potentially influencing various biochemical pathways. The presence of the tert-butyl group can enhance lipophilicity, which may affect its pharmacokinetic properties. Additionally, the pyrazolo[3,4-b]pyridine framework is known for its versatility in drug design, often serving as a scaffold for developing compounds with diverse therapeutic applications. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, which can be leveraged in various chemical reactions or applications in materials science. Overall, this compound represents a significant area of interest for researchers exploring novel pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₄N₄

InChI: InChI=1/C10H14N4/c1-10(2,3)7-5-4-6-8(11)13-14-9(6)12-7/h4-5H,1-3H3,(H3,11,12,13,14)

SMILES: CC(C)(C)c1ccc2c(N)[nH]nc2n1

Synonyms:

• 1H-pyrazolo[3,4-b]pyridin-3-amine, 6-(1,1-dimethylethyl)-

6-tert-butyl-1H-pyrazolo[3,4-b]pyridin-3-amine

CAS: 951626-63-4

Purity: 95+%

Molecular weight: 190.25

Ref: 10-F723909

6-tert-Butyl-1H-pyrazolo[3,4-b]pyridin-3-amine

CAS: 951626-63-4

Formula: C₁₀H₁₄N₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 190.25

Ref: 10-F061498