CAS 951677-39-7
:2,3-Dichloropyridine-4-boronic acid
Description:
2,3-Dichloropyridine-4-boronic acid is an organoboron compound characterized by the presence of both a boronic acid functional group and a dichlorinated pyridine ring. This compound typically appears as a solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group, which can form hydrogen bonds. The dichlorinated pyridine structure contributes to its reactivity, making it useful in various chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key intermediate for synthesizing biaryl compounds. The boronic acid moiety allows for the formation of stable complexes with diols, which is significant in applications such as drug development and materials science. Additionally, 2,3-Dichloropyridine-4-boronic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as boronic acids can be sensitive to moisture and may require careful handling. Overall, this compound is valued for its versatility in organic synthesis and potential applications in pharmaceuticals.
Formula:C5H4BCl2NO2
InChI:InChI=1/C5H4BCl2NO2/c7-4-3(6(10)11)1-2-9-5(4)8/h1-2,10-11H
SMILES:c1cnc(c(c1B(O)O)Cl)Cl
Synonyms:- (2,3-Dichloropyridin-4-yl)boronic acid
- 2,3-Dichloro-4-pyridineboronic acid
- 2,3-Dichloropyridin-4-ylboronic acid
- B-(2,3-Dichloro-4-pyridinyl)boronic acid
- boronic acid, B-(2,3-dichloro-4-pyridinyl)-
- T6Nj Bg Cg Dbqq
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Dichloropyridine-4-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H4BCl2NO2Purity:gt. 97.0 and le 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:191.802,3-Dichloropyridine-4-boronic acid
CAS:Formula:C5H4BCl2NO2Purity:%Color and Shape:SolidMolecular weight:191.80782,3-Dichloropyridine-4-boronic acid
CAS:2,3-Dichloropyridine-4-boronic acidPurity:98%Color and Shape:White PowderMolecular weight:191.81g/mol2,3-Dichloropyridine-4-boronic acid
CAS:Formula:C5H4BCl2NO2Purity:97%Color and Shape:Liquid, No data available.Molecular weight:191.8



