
CAS 951745-14-5
:2-Methoxy-3-[(1E)-2-nitroethenyl]pyridine
Description:
2-Methoxy-3-[(1E)-2-nitroethenyl]pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a nitroethenyl substituent, which contributes to its reactivity and potential applications in various chemical processes. The presence of the nitro group (-NO2) typically enhances the electrophilic character of the molecule, making it useful in synthetic organic chemistry. The methoxy group can influence the compound's solubility and polarity, affecting its interactions in biological systems or chemical reactions. Additionally, the compound may exhibit specific spectral properties, such as UV-Vis and NMR characteristics, which can be utilized for its identification and analysis. Due to its unique structure, 2-Methoxy-3-[(1E)-2-nitroethenyl]pyridine may have potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed studies on its biological activity and environmental impact would be necessary to fully understand its utility and safety profile.
Formula:C8H8N2O3
InChI:InChI=1S/C8H8N2O3/c1-13-8-7(3-2-5-9-8)4-6-10(11)12/h2-6H,1H3/b6-4+
InChI key:InChIKey=VIUCBGSTPGAJFM-GQCTYLIASA-N
SMILES:C(=C/N(=O)=O)\C1=C(OC)N=CC=C1
Synonyms:- 2-Methoxy-3-[(1E)-2-nitroethenyl]pyridine
- Pyridine, 2-methoxy-3-[(1E)-2-nitroethenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.