CAS 951771-28-1

1,1′-[(4-Bromophenyl)methylene]bis[5-bromo-2-methoxybenzene]

Description:

1,1′-[(4-Bromophenyl)methylene]bis[5-bromo-2-methoxybenzene], identified by its CAS number 951771-28-1, is an organic compound characterized by its complex structure featuring multiple bromine and methoxy substituents. This compound is a bis-aryl derivative, which indicates that it contains two aryl groups connected by a methylene bridge. The presence of bromine atoms enhances its reactivity and may influence its electronic properties, making it potentially useful in various chemical applications, including organic synthesis and materials science. The methoxy groups contribute to its solubility and can affect its interaction with other molecules. Additionally, the compound's structural features suggest potential applications in pharmaceuticals or as a precursor in the synthesis of more complex organic molecules. Its physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, as they can vary based on purity and environmental conditions. Overall, this compound exemplifies the diversity of brominated organic compounds in chemical research and applications.

Formula: C₂₁H₁₇Br₃O₂

InChI: InChI=1S/C21H17Br3O2/c1-25-19-9-7-15(23)11-17(19)21(13-3-5-14(22)6-4-13)18-12-16(24)8-10-20(18)26-2/h3-12,21H,1-2H3

InChI key: InChIKey=ILSVCHWZQGLOQI-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(Br)=C1)(C2=C(OC)C=CC(Br)=C2)C3=CC=C(Br)C=C3

Synonyms:

• Benzene, 1,1′-[(4-bromophenyl)methylene]bis[5-bromo-2-methoxy-
• 1,1′-[(4-Bromophenyl)methylene]bis[5-bromo-2-methoxybenzene]
• 2,2′-((4-bromophenyl)methylene)bis(4-bromo-1-methoxybenzene)