CAS 951884-07-4

1-[(2-Bromophenyl)sulfonyl]-4-methyl-1H-imidazole

Description:

1-[(2-Bromophenyl)sulfonyl]-4-methyl-1H-imidazole is a chemical compound characterized by its unique structure, which includes an imidazole ring substituted with a methyl group and a sulfonyl group attached to a 2-bromophenyl moiety. This compound typically exhibits properties associated with both the imidazole and sulfonyl functional groups, such as potential biological activity and solubility in various organic solvents. The presence of the bromine atom may influence its reactivity and interactions in chemical reactions, while the sulfonyl group can enhance its polarity and solubility. Additionally, compounds like this one are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The molecular structure contributes to its potential as a ligand or inhibitor in various biochemical processes. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental conditions and the presence of other chemical species.

Formula: C₁₀H₉BrN₂O₂S

InChI: InChI=1S/C10H9BrN2O2S/c1-8-6-13(7-12-8)16(14,15)10-5-3-2-4-9(10)11/h2-7H,1H3

InChI key: InChIKey=CEUSAKOLFNCHJC-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(Br)C=CC=C1)N2C=C(C)N=C2

Synonyms:

• 1-[(2-Bromophenyl)sulfonyl]-4-methyl-1H-imidazole
• 1H-Imidazole, 1-[(2-bromophenyl)sulfonyl]-4-methyl-

1-(2-Bromophenylsulfonyl)-4-methyl-1H-imidazole

CAS: 951884-07-4

Formula: C₁₀H₉BrN₂O₂S

Molecular weight: 301.1597

Ref: IN-DA003CRU

1-[(2-Bromophenyl)sulphonyl]-4-methyl-1H-imidazole

CAS: 951884-07-4

1-[(2-Bromophenyl)sulphonyl]-4-methyl-1H-imidazole

Purity: ≥95%

Molecular weight: 301.16g/mol

Ref: 54-OR11603