CAS 951884-37-0

(3,5-Dimethylphenyl)(4-iodophenyl)methanone

Description:

(3,5-Dimethylphenyl)(4-iodophenyl)methanone, identified by its CAS number 951884-37-0, is an organic compound characterized by its ketone functional group, specifically a carbonyl group (C=O) bonded to a methylene bridge connecting two aromatic rings. The compound features a 3,5-dimethylphenyl group, which contributes to its hydrophobic character and potential steric hindrance, and a 4-iodophenyl group, which introduces an iodine atom that can influence the compound's reactivity and electronic properties. This structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of both electron-donating (methyl groups) and electron-withdrawing (iodine) substituents. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Additionally, its reactivity may be influenced by the presence of the iodine atom, which can participate in various chemical reactions, including nucleophilic substitutions.

Formula: C₁₅H₁₃IO

InChI: InChI=1S/C15H13IO/c1-10-7-11(2)9-13(8-10)15(17)12-3-5-14(16)6-4-12/h3-9H,1-2H3

InChI key: InChIKey=KOYYNYIOZGRLNB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C)=CC(C)=C1)C2=CC=C(I)C=C2

Synonyms:

• (3,5-Dimethylphenyl)(4-iodophenyl)methanone
• Methanone, (3,5-dimethylphenyl)(4-iodophenyl)-
• 4-Iodo-3,5-dimethylbenzophenone
• 3,5-DIMETHYL-4'-IODOBENZOPHENONE