CAS 951884-81-4
:3-Bromo-N-(3-methoxypropyl)-5-(trifluoromethyl)benzenesulfonamide
Description:
3-Bromo-N-(3-methoxypropyl)-5-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a bromine atom, a trifluoromethyl group, and a sulfonamide functional group. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the trifluoromethyl group can enhance lipophilicity and influence biological activity. The methoxypropyl substituent contributes to the compound's solubility and steric properties. This compound is likely to exhibit properties typical of sulfonamides, such as antibacterial activity, although specific biological activities would depend on the overall molecular structure and substituents. Additionally, the trifluoromethyl group may impart unique electronic characteristics, affecting the compound's reactivity and interaction with biological targets. Overall, this compound's unique combination of functional groups makes it a candidate for various applications in medicinal chemistry and material science, although further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C11H13BrF3NO3S
InChI:InChI=1S/C11H13BrF3NO3S/c1-19-4-2-3-16-20(17,18)10-6-8(11(13,14)15)5-9(12)7-10/h5-7,16H,2-4H2,1H3
InChI key:InChIKey=CYVCCTWSYFXOMU-UHFFFAOYSA-N
SMILES:S(NCCCOC)(=O)(=O)C1=CC(C(F)(F)F)=CC(Br)=C1
Synonyms:- 3-Bromo-N-(3-methoxypropyl)-5-(trifluoromethyl)benzenesulfonamide
- Benzenesulfonamide, 3-bromo-N-(3-methoxypropyl)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-(3-Methoxypropyl) 3-bromo-5-trifluoromethylbenzenesulfonamide
CAS:Formula:C11H13BrF3NO3SMolecular weight:376.19003-Bromo-5-[N-(3-methoxypropyl)sulphamoyl]benzotrifluoride
CAS:<p>3-Bromo-5-[N-(3-methoxypropyl)sulphamoyl]benzotrifluoride</p>Molecular weight:376.19g/mol

