CAS 951885-07-7
:5-Fluoro-β,2-dimethyl-δ-oxobenzenepentanoic acid
Description:
5-Fluoro-β,2-dimethyl-δ-oxobenzenepentanoic acid, identified by its CAS number 951885-07-7, is a synthetic organic compound that features a complex structure characterized by a fluorinated aromatic ring and a pentanoic acid moiety. The presence of the fluoro group typically enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The β,2-dimethyl substituents suggest steric hindrance, which may affect the compound's reactivity and interactions with biological targets. The δ-oxobenzene structure indicates the presence of a ketone functional group adjacent to the aromatic system, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may exhibit unique pharmacological properties, potentially serving as a lead compound in drug development. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments. Overall, 5-Fluoro-β,2-dimethyl-δ-oxobenzenepentanoic acid represents a valuable compound for further research in organic and medicinal chemistry.
Formula:C13H15FO3
InChI:InChI=1S/C13H15FO3/c1-8(6-13(16)17)5-12(15)11-7-10(14)4-3-9(11)2/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)
InChI key:InChIKey=CNZHUZIDDMGKNP-UHFFFAOYSA-N
SMILES:C(CC(CC(O)=O)C)(=O)C1=C(C)C=CC(F)=C1
Synonyms:- 5-Fluoro-β,2-dimethyl-δ-oxobenzenepentanoic acid
- Benzenepentanoic acid, 5-fluoro-β,2-dimethyl-δ-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.