CymitQuimica logo

CAS 951885-19-1

:

6-Chloro-N-propyl-3-pyridazinamine

Description:
6-Chloro-N-propyl-3-pyridazinamine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and a propyl group at the nitrogen atom contributes to its unique properties. This compound is typically classified as an amine due to the presence of the amino group (-NH2) attached to the pyridazine structure. It may exhibit moderate solubility in polar solvents, influenced by the functional groups present. The chlorine substituent can enhance the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the pyridazine core can lead to compounds with specific biological activities. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, which can be leveraged in material science or organic synthesis. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C7H10ClN3
InChI:InChI=1S/C7H10ClN3/c1-2-5-9-7-4-3-6(8)10-11-7/h3-4H,2,5H2,1H3,(H,9,11)
InChI key:InChIKey=QXJWIXPQOHPVFC-UHFFFAOYSA-N
SMILES:N(CCC)C1=CC=C(Cl)N=N1
Synonyms:
  • 3-Chloro-6-propylaminopyridazine
  • 3-Pyridazinamine, 6-chloro-N-propyl-
  • 6-Chloro-N-propyl-3-pyridazinamine
  • N-(6-Chloro-pyridazin-3-yl) propylamine
Found 4 products.