CAS 951885-29-3
:(3,4-Difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Description:
(3,4-Difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone, with the CAS number 951885-29-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a difluorophenyl group and a benzodioxin moiety. This compound typically exhibits properties associated with aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The difluorophenyl group may impart unique electronic properties, influencing its reactivity and interaction with biological targets. The benzodioxin structure contributes to its potential applications in medicinal chemistry, particularly in drug development, due to its ability to interact with various biological pathways. The compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. Overall, this compound represents a class of molecules that may have significant implications in pharmacology and material science, warranting further investigation into its biological activity and potential applications.
Formula:C15H10F2O3
InChI:InChI=1S/C15H10F2O3/c16-11-3-1-9(7-12(11)17)15(18)10-2-4-13-14(8-10)20-6-5-19-13/h1-4,7-8H,5-6H2
InChI key:InChIKey=PJYBYDHLKYXKQD-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C2C(=CC1)OCCO2)C3=CC(F)=C(F)C=C3
Synonyms:- Methanone, (3,4-difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)-
- (3,4-Difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.