CAS 951885-32-8
:(3,5-Difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Description:
(3,5-Difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone, with the CAS number 951885-32-8, is a synthetic organic compound characterized by its complex structure, which includes a difluorophenyl group and a benzodioxin moiety. This compound typically exhibits properties associated with aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The difluorophenyl group may impart unique electronic properties, influencing its reactivity and interactions in chemical reactions. The benzodioxin structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with similar structures. Its specific applications and biological activities would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses. Overall, this compound represents a class of molecules that may have implications in drug development and other chemical applications.
Formula:C15H10F2O3
InChI:InChI=1S/C15H10F2O3/c16-11-5-10(6-12(17)8-11)15(18)9-1-2-13-14(7-9)20-4-3-19-13/h1-2,5-8H,3-4H2
InChI key:InChIKey=HZXVQNMFVYIXOF-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C2C(=CC1)OCCO2)C3=CC(F)=CC(F)=C3
Synonyms:- Methanone, (3,5-difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)-
- (3,5-Difluorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.