CAS 951885-41-9

(2-Chlorophenyl)[4-(ethylthio)phenyl]methanone

Description:

(2-Chlorophenyl)[4-(ethylthio)phenyl]methanone, with the CAS number 951885-41-9, is an organic compound characterized by its complex structure, which includes a chlorinated phenyl group and an ethylthio-substituted phenyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with ketones, such as being a solid at room temperature, with potential solubility in organic solvents like dichloromethane or ethanol. The presence of the chlorine atom introduces electronegative characteristics, influencing its reactivity and polarity. The ethylthio group can enhance the compound's lipophilicity, potentially affecting its biological activity and interactions. Such compounds may be of interest in pharmaceutical chemistry for their potential applications in drug development, particularly in the synthesis of biologically active molecules. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis.

Formula: C₁₅H₁₃ClOS

InChI: InChI=1S/C15H13ClOS/c1-2-18-12-9-7-11(8-10-12)15(17)13-5-3-4-6-14(13)16/h3-10H,2H2,1H3

InChI key: InChIKey=REKQAYAJWSLZLG-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(SCC)C=C1)C2=C(Cl)C=CC=C2

Synonyms:

• (2-Chlorophenyl)[4-(ethylthio)phenyl]methanone
• Methanone, (2-chlorophenyl)[4-(ethylthio)phenyl]-
• 2-Chloro-4′-(ethylthio)benzophenone