CAS 951885-46-4

Phenol, 3-bromo-4-methoxy-, 1-methanesulfonate

Description:

Phenol, 3-bromo-4-methoxy-, 1-methanesulfonate, with the CAS number 951885-46-4, is an organic compound characterized by the presence of a phenolic structure substituted with a bromine atom at the 3-position and a methoxy group at the 4-position. The methanesulfonate group serves as a leaving group, making this compound potentially useful in various chemical reactions, particularly in nucleophilic substitution processes. The presence of the bromine atom can enhance the reactivity of the phenolic compound, while the methoxy group may influence its solubility and electronic properties. This compound is likely to exhibit moderate polarity due to the functional groups present, which can affect its interactions in biological systems and its solubility in organic solvents. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules, owing to its functionalized nature. Safety and handling precautions should be observed, as with many brominated and sulfonated compounds, due to potential toxicity and environmental impact.

Formula: C₈H₉BrO₄S

InChI: InChI=1S/C8H9BrO4S/c1-12-8-4-3-6(5-7(8)9)13-14(2,10)11/h3-5H,1-2H3

InChI key: InChIKey=OKYUXDVBQAPOJE-UHFFFAOYSA-N

SMILES: O(S(C)(=O)=O)C1=CC(Br)=C(OC)C=C1

Synonyms:

• Phenol, 3-bromo-4-methoxy-, 1-methanesulfonate

3-Bromo-4-methoxyphenyl mesylate

CAS: 951885-46-4

Formula: C₈H₉BrO₄S

Molecular weight: 281.1237

Ref: IN-DA003J26

3-Bromo-4-methoxyphenyl methylsulphonate

CAS: 951885-46-4

3-Bromo-4-methoxyphenyl methylsulphonate

Purity: ≥95%

Molecular weight: 281.12g/mol

Ref: 54-OR11998