CAS 951885-47-5
:(4-Bromophenyl)[4-(ethylthio)phenyl]methanone
Description:
(4-Bromophenyl)[4-(ethylthio)phenyl]methanone, with the CAS number 951885-47-5, is an organic compound characterized by its complex structure, which includes a bromophenyl group and an ethylthio-substituted phenyl group attached to a ketone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and the potential for electrophilic substitution reactions due to the presence of the bromine atom, which can influence reactivity. The ethylthio group may enhance solubility in organic solvents and can also affect the compound's electronic properties. As a ketone, it contains a carbonyl group (C=O), which is polar and can participate in hydrogen bonding, influencing its physical properties like boiling and melting points. The presence of both bromine and sulfur in the structure may impart unique biological activities, making it of interest in medicinal chemistry and material science. Overall, this compound's characteristics make it a subject of interest for further research in various chemical applications.
Formula:C15H13BrOS
InChI:InChI=1S/C15H13BrOS/c1-2-18-14-9-5-12(6-10-14)15(17)11-3-7-13(16)8-4-11/h3-10H,2H2,1H3
InChI key:InChIKey=UCYOGWYAPVNCIV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(SCC)C=C1)C2=CC=C(Br)C=C2
Synonyms:- (4-Bromophenyl)[4-(ethylthio)phenyl]methanone
- Methanone, (4-bromophenyl)[4-(ethylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.