CAS 951885-53-3

[4-(Ethylthio)phenyl](3-iodophenyl)methanone

Description:

[4-(Ethylthio)phenyl](3-iodophenyl)methanone, with the CAS number 951885-53-3, is an organic compound characterized by its complex structure that includes both an ethylthio group and an iodo-substituted phenyl group. This compound features a ketone functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the ethylthio group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The iodine atom in the structure can serve as a leaving group in reactions, facilitating further transformations. Additionally, the compound's aromatic rings contribute to its stability and may allow for π-π stacking interactions in solid-state applications. Overall, this compound's unique combination of functional groups and substituents suggests potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₅H₁₃IOS

InChI: InChI=1S/C15H13IOS/c1-2-18-14-8-6-11(7-9-14)15(17)12-4-3-5-13(16)10-12/h3-10H,2H2,1H3

InChI key: InChIKey=IQXVLQXCOZZTKN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(I)=CC=C1)C2=CC=C(SCC)C=C2

Synonyms:

• [4-(Ethylthio)phenyl](3-iodophenyl)methanone
• Methanone, [4-(ethylthio)phenyl](3-iodophenyl)-

4-(Ethylthio)-3′-iodobenzophenone

CAS: 951885-53-3

Formula: C₁₅H₁₃IOS

Purity: 97.0%

Molecular weight: 368.23

Ref: 10-F202097