CAS 951885-56-6

[4-(Ethylthio)phenyl](4-iodophenyl)methanone

Description:

[4-(Ethylthio)phenyl](4-iodophenyl)methanone, with the CAS number 951885-56-6, is an organic compound characterized by its complex structure that includes both ethylthio and iodo substituents on a phenyl ring. This compound typically exhibits a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ethylthio group can enhance its solubility in organic solvents and may influence its electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The iodo substituent can also serve as a leaving group in reactions, facilitating further transformations. Additionally, the compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in materials science and organic electronics, where such functionalized compounds can play a role in the development of new materials. Overall, [4-(Ethylthio)phenyl](4-iodophenyl)methanone is a versatile compound with significant implications in both synthetic chemistry and potential medicinal applications.

Formula: C₁₅H₁₃IOS

InChI: InChI=1S/C15H13IOS/c1-2-18-14-9-5-12(6-10-14)15(17)11-3-7-13(16)8-4-11/h3-10H,2H2,1H3

InChI key: InChIKey=TYDZTCCHLQMVIG-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(SCC)C=C1)C2=CC=C(I)C=C2

Synonyms:

• [4-(Ethylthio)phenyl](4-iodophenyl)methanone
• Methanone, [4-(ethylthio)phenyl](4-iodophenyl)-
• 4-(Ethylthio)-4′-iodobenzophenone

4-(Ethylthio)-4′-iodobenzophenone

CAS: 951885-56-6

Formula: C₁₅H₁₃IOS

Purity: 97.0%

Molecular weight: 368.23

Ref: 10-F202098