CAS 951885-58-8

2-[(4-Bromobenzoyl)amino]ethyl 4-bromobenzoate

Description:

2-[(4-Bromobenzoyl)amino]ethyl 4-bromobenzoate is an organic compound characterized by its complex structure, which includes both amine and ester functional groups. The presence of bromine atoms in the benzoyl and benzoate moieties contributes to its unique chemical properties, such as increased reactivity and potential for halogen bonding. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its polar functional groups may enhance solubility in polar solvents. The compound may also demonstrate biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of bromine can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Overall, 2-[(4-Bromobenzoyl)amino]ethyl 4-bromobenzoate is a noteworthy compound for further investigation in both synthetic and medicinal chemistry contexts.

Formula: C₁₆H₁₃Br₂NO₃

InChI: InChI=1S/C16H13Br2NO3/c17-13-5-1-11(2-6-13)15(20)19-9-10-22-16(21)12-3-7-14(18)8-4-12/h1-8H,9-10H2,(H,19,20)

InChI key: InChIKey=WBXUMECQTYYWLO-UHFFFAOYSA-N

SMILES: C(NCCOC(=O)C1=CC=C(Br)C=C1)(=O)C2=CC=C(Br)C=C2

Synonyms:

• 2-[(4-Bromobenzoyl)amino]ethyl 4-bromobenzoate
• Benzoic acid, 4-bromo-, 2-[(4-bromobenzoyl)amino]ethyl ester

2-(4-Bromobenzamido)ethyl 4-bromobenzoate

CAS: 951885-58-8

Formula: C₁₆H₁₃Br₂NO₃

Molecular weight: 427.0873

Ref: IN-DA003EV1

2-[(4-Bromobenzoyl)amino]ethyl 4-bromobenzoate

CAS: 951885-58-8

2-[(4-Bromobenzoyl)amino]ethyl 4-bromobenzoate

Purity: ≥95%

Molecular weight: 427.09g/mol

Ref: 54-OR11970