CymitQuimica logo

CAS 951885-70-4

:

6-Bromo-N-ethyl-3-pyridinecarboxamide

Description:
6-Bromo-N-ethyl-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The N-ethyl group indicates that there is an ethyl substituent attached to the nitrogen atom of the amide functional group, which can influence the compound's solubility and biological activity. As a carboxamide, it features a carbonyl group (C=O) directly bonded to the nitrogen atom, which is typical for amides and can affect the compound's hydrogen bonding capabilities. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular structure and interactions with solvents. Overall, 6-Bromo-N-ethyl-3-pyridinecarboxamide is a versatile compound with potential applications in research and development.
Formula:C8H9BrN2O
InChI:InChI=1S/C8H9BrN2O/c1-2-10-8(12)6-3-4-7(9)11-5-6/h3-5H,2H2,1H3,(H,10,12)
InChI key:InChIKey=YZKAGMRJEOWXIP-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C=1C=CC(Br)=NC1
Synonyms:
  • 6-Bromo-N-ethyl-3-pyridinecarboxamide
  • 3-Pyridinecarboxamide, 6-bromo-N-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.