CAS 951885-80-6

Ethyl 3-(dimethylamino)-γ-oxobenzenebutanoate

Description:

Ethyl 3-(dimethylamino)-γ-oxobenzenebutanoate, identified by its CAS number 951885-80-6, is a chemical compound that belongs to the class of esters. It features a complex structure that includes an ethyl ester group, a dimethylamino moiety, and a γ-oxobenzenebutanoate framework. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the dimethylamino group, known for its basicity and ability to form hydrogen bonds. The γ-oxobenzenebutanoate portion contributes to its reactivity and may influence its solubility and stability in different solvents. Ethyl 3-(dimethylamino)-γ-oxobenzenebutanoate may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. However, detailed studies on its toxicity, environmental impact, and specific applications are necessary to fully understand its characteristics and utility in various fields.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1S/C14H19NO3/c1-4-18-14(17)9-8-13(16)11-6-5-7-12(10-11)15(2)3/h5-7,10H,4,8-9H2,1-3H3

InChI key: InChIKey=YZYRRRNQYWZTKZ-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)(=O)C1=CC(N(C)C)=CC=C1

Synonyms:

• Ethyl 3-(dimethylamino)-γ-oxobenzenebutanoate
• Benzenebutanoic acid, 3-(dimethylamino)-γ-oxo-, ethyl ester

Ethyl 4-[3-(N,N-Dimethylamino)phenyl]-4-oxobutanoate

CAS: 951885-80-6

Formula: C₁₄H₁₉NO₃

Purity: 97.0%

Molecular weight: 249.31

Ref: 10-F208080