CAS 951885-84-0
:2-Chloro-5-(2-chloro-2-propen-1-yl)thiophene
Description:
2-Chloro-5-(2-chloro-2-propen-1-yl)thiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features two chlorine substituents and a propenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the chlorine atoms enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The thiophene moiety provides unique electronic properties, which can be exploited in materials science, particularly in the development of organic semiconductors and photovoltaic devices. Additionally, the compound's structure suggests potential applications in agrochemicals or pharmaceuticals, where halogenated compounds often exhibit enhanced biological activity. Its CAS number, 951885-84-0, allows for precise identification in chemical databases and literature. Overall, 2-Chloro-5-(2-chloro-2-propen-1-yl)thiophene is a versatile compound with significant implications in both synthetic chemistry and material science.
Formula:C7H6Cl2S
InChI:InChI=1S/C7H6Cl2S/c1-5(8)4-6-2-3-7(9)10-6/h2-3H,1,4H2
InChI key:InChIKey=JUMZQKGOYLNUAB-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C=1SC(Cl)=CC1
Synonyms:- 2-Chloro-5-(2-chloro-2-propen-1-yl)thiophene
- Thiophene, 2-chloro-5-(2-chloro-2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.