CAS 951885-86-2

Ethyl 3-(dimethylamino)-ε-oxobenzenehexanoate

Description:

Ethyl 3-(dimethylamino)-ε-oxobenzenehexanoate, identified by its CAS number 951885-86-2, is an organic compound characterized by its complex structure, which includes an ethyl ester group, a dimethylamino moiety, and a benzene ring with a keto functional group. This compound typically exhibits properties associated with esters, such as being a liquid at room temperature and having a characteristic odor. Its dimethylamino group may impart basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and protonation. The presence of the benzene ring suggests potential for aromatic interactions, which can influence its solubility and reactivity. Ethyl 3-(dimethylamino)-ε-oxobenzenehexanoate may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that can facilitate further chemical modifications. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper use and minimize risks.

Formula: C₁₆H₂₃NO₃

InChI: InChI=1S/C16H23NO3/c1-4-20-16(19)11-6-5-10-15(18)13-8-7-9-14(12-13)17(2)3/h7-9,12H,4-6,10-11H2,1-3H3

InChI key: InChIKey=FDJFKYGNWYKXGI-UHFFFAOYSA-N

SMILES: C(CCCCC(OCC)=O)(=O)C1=CC(N(C)C)=CC=C1

Synonyms:

• Benzenehexanoic acid, 3-(dimethylamino)-ε-oxo-, ethyl ester
• Ethyl 3-(dimethylamino)-ε-oxobenzenehexanoate

Ethyl 6-[3-(N,N-Dimethylamino)phenyl]-6-oxohexanoate

CAS: 951885-86-2

Formula: C₁₆H₂₃NO₃

Purity: 97.0%

Molecular weight: 277.364

Ref: 10-F208082