CAS 951885-97-5

Methanone, (2-bromophenyl)(3-fluoro-4-methoxyphenyl)-

Description:

Methanone, (2-bromophenyl)(3-fluoro-4-methoxyphenyl)-, also known by its CAS number 951885-97-5, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic substituents. The compound features a bromine atom at the 2-position of one phenyl ring and a fluorine atom along with a methoxy group at the 3- and 4-positions, respectively, of the other phenyl ring. This structural arrangement contributes to its unique chemical properties, including potential reactivity and solubility characteristics influenced by the electronegative halogen atoms and the methoxy group. The presence of these substituents can also affect the compound's electronic properties, making it of interest in various chemical applications, including medicinal chemistry and material science. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, which may be explored in drug development or other chemical research contexts.

Formula: C₁₄H₁₀BrFO₂

InChI: InChI=1S/C14H10BrFO2/c1-18-13-7-6-9(8-12(13)16)14(17)10-4-2-3-5-11(10)15/h2-8H,1H3

InChI key: InChIKey=JWULDKRPAFHYEA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(OC)C=C1)C2=C(Br)C=CC=C2

Synonyms:

• 2-Bromo-3′-fluoro-4′-methoxybenzophenone
• Methanone, (2-bromophenyl)(3-fluoro-4-methoxyphenyl)-
• (2-Bromophenyl)-(3-fluoro-4-methoxyphenyl)methanone