CAS 951886-03-6
:(3-Fluoro-4-methoxyphenyl)(3-iodophenyl)methanone
Description:
(3-Fluoro-4-methoxyphenyl)(3-iodophenyl)methanone, with the CAS number 951886-03-6, is an organic compound characterized by its complex aromatic structure. It features a methanone functional group, which is a ketone where the carbonyl carbon is bonded to two aromatic rings. The presence of a fluorine atom and a methoxy group on one phenyl ring, along with an iodine substituent on the other, contributes to its unique chemical properties. These substituents can influence the compound's reactivity, stability, and potential applications in medicinal chemistry or material science. The fluorine atom often enhances lipophilicity and metabolic stability, while the iodine can facilitate certain types of chemical reactions, such as nucleophilic substitutions. The methoxy group may also affect the electronic properties of the molecule, potentially influencing its interaction with biological targets. Overall, this compound exemplifies the diverse functionalities that can arise from the strategic placement of halogens and other substituents on aromatic systems.
Formula:C14H10FIO2
InChI:InChI=1S/C14H10FIO2/c1-18-13-6-5-10(8-12(13)15)14(17)9-3-2-4-11(16)7-9/h2-8H,1H3
InChI key:InChIKey=ZKDRDVSZAPMHSM-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(OC)C=C1)C2=CC(I)=CC=C2
Synonyms:- (3-Fluoro-4-methoxyphenyl)(3-iodophenyl)methanone
- Methanone, (3-fluoro-4-methoxyphenyl)(3-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.