CAS 951886-04-7

Ethyl 4-(diethylamino)-γ-oxobenzenebutanoate

Description:

Ethyl 4-(diethylamino)-γ-oxobenzenebutanoate, identified by its CAS number 951886-04-7, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester group and a diethylamino moiety. This compound typically exhibits properties associated with both esters and amines, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The γ-oxobenzenebutanoate structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its unique functional groups may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the presence of the diethylamino group can influence its pharmacokinetic properties, such as permeability and bioavailability. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks associated with chemical exposure. Overall, this compound's characteristics make it a subject of interest in both synthetic chemistry and medicinal applications.

Formula: C₁₆H₂₃NO₃

InChI: InChI=1S/C16H23NO3/c1-4-17(5-2)14-9-7-13(8-10-14)15(18)11-12-16(19)20-6-3/h7-10H,4-6,11-12H2,1-3H3

InChI key: InChIKey=BZAOIVGZJPYYBE-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=CC=C(C(CCC(OCC)=O)=O)C=C1

Synonyms:

• Benzenebutanoic acid, 4-(diethylamino)-γ-oxo-, ethyl ester
• Ethyl 4-(diethylamino)-γ-oxobenzenebutanoate

Ethyl 4-[4-(N,N-Diethylamino)phenyl]-4-oxobutanoate

CAS: 951886-04-7

Formula: C₁₆H₂₃NO₃

Purity: 97.0%

Molecular weight: 277.364

Ref: 10-F208090