CAS 951886-07-0

Ethyl 4-(diethylamino)-δ-oxobenzenepentanoate

Description:

Ethyl 4-(diethylamino)-δ-oxobenzenepentanoate, identified by its CAS number 951886-07-0, is a chemical compound that belongs to the class of esters. This substance features a complex structure characterized by the presence of a diethylamino group, which contributes to its potential biological activity. The compound typically exhibits moderate to high lipophilicity due to its alkyl chains, which can influence its solubility in organic solvents and its permeability through biological membranes. Ethyl 4-(diethylamino)-δ-oxobenzenepentanoate may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with various biological targets, which could be explored for therapeutic applications. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. As with any chemical substance, proper handling and safety measures should be observed to mitigate any risks associated with its use.

Formula: C₁₇H₂₅NO₃

InChI: InChI=1S/C17H25NO3/c1-4-18(5-2)15-12-10-14(11-13-15)16(19)8-7-9-17(20)21-6-3/h10-13H,4-9H2,1-3H3

InChI key: InChIKey=MEMHXVFKUDPCHB-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=CC=C(C(CCCC(OCC)=O)=O)C=C1

Synonyms:

• Benzenepentanoic acid, 4-(diethylamino)-δ-oxo-, ethyl ester
• Ethyl 4-(diethylamino)-δ-oxobenzenepentanoate

Ethyl 5-[4-(N,N-Diethylamino)phenyl]-5-oxovalerate

CAS: 951886-07-0

Formula: C₁₇H₂₅NO₃

Purity: 97.0%

Molecular weight: 291.391

Ref: 10-F208091