CAS 951886-24-1

(2-Bromophenyl)(3-fluoro-4-methylphenyl)methanone

Description:

(2-Bromophenyl)(3-fluoro-4-methylphenyl)methanone, with the CAS number 951886-24-1, is an organic compound characterized by its structure, which features a ketone functional group attached to two aromatic rings. The presence of bromine and fluorine substituents on the phenyl rings contributes to its unique chemical properties, including potential reactivity and polarity. The bromine atom, being a good leaving group, may facilitate nucleophilic substitution reactions, while the fluorine atom can influence the compound's electronic properties and stability. This compound may exhibit moderate solubility in organic solvents due to its aromatic nature, and its melting and boiling points can vary based on the intermolecular interactions. Additionally, the presence of the methyl group on one of the phenyl rings can affect steric hindrance and reactivity. Overall, this compound may be of interest in pharmaceutical research and organic synthesis due to its potential biological activity and utility in various chemical reactions.

Formula: C₁₄H₁₀BrFO

InChI: InChI=1S/C14H10BrFO/c1-9-6-7-10(8-13(9)16)14(17)11-4-2-3-5-12(11)15/h2-8H,1H3

InChI key: InChIKey=MMZCVYUDVSQWCJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(C)C=C1)C2=C(Br)C=CC=C2

Synonyms:

• (2-Bromophenyl)(3-fluoro-4-methylphenyl)methanone
• Methanone, (2-bromophenyl)(3-fluoro-4-methylphenyl)-