CAS 951886-27-4

(3-Fluoro-4-methylphenyl)(2-iodophenyl)methanone

Description:

(3-Fluoro-4-methylphenyl)(2-iodophenyl)methanone, identified by its CAS number 951886-27-4, is an organic compound characterized by its unique molecular structure, which includes a ketone functional group attached to two aromatic rings. The presence of a fluorine atom and an iodine atom in the phenyl groups contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. The fluorine atom can enhance the compound's lipophilicity and influence its biological activity, while the iodine atom may facilitate further functionalization or serve as a leaving group in synthetic pathways. This compound may exhibit interesting properties such as altered solubility, stability, and reactivity compared to its non-halogenated counterparts. Its specific applications could range from pharmaceuticals to materials science, depending on the interactions of the halogen substituents with biological systems or other chemical entities. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₄H₁₀FIO

InChI: InChI=1S/C14H10FIO/c1-9-6-7-10(8-12(9)15)14(17)11-4-2-3-5-13(11)16/h2-8H,1H3

InChI key: InChIKey=YZMBEXCFRQVRSH-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(F)=C(C)C=C1)C2=C(I)C=CC=C2

Synonyms:

• Methanone, (3-fluoro-4-methylphenyl)(2-iodophenyl)-
• (3-Fluoro-4-methylphenyl)(2-iodophenyl)methanone