CymitQuimica logo

CAS 951886-38-7

:

Ethyl 5-(3-chloro-3-buten-1-yl)-2-furancarboxylate

Description:
Ethyl 5-(3-chloro-3-buten-1-yl)-2-furancarboxylate is an organic compound characterized by its unique structure, which includes a furan ring and a chloroalkene substituent. The presence of the furan moiety contributes to its potential reactivity and biological activity, as furan derivatives are known for their diverse applications in pharmaceuticals and agrochemicals. The chloro-3-butenyl group introduces a site for nucleophilic attack, making the compound potentially useful in various synthetic pathways. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents suggests it may be utilized in organic synthesis and as an intermediate in the production of more complex molecules. Additionally, the compound's properties, such as boiling point, melting point, and reactivity, would be influenced by the functional groups present and their interactions. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit toxicity and environmental concerns.
Formula:C11H13ClO3
InChI:InChI=1S/C11H13ClO3/c1-3-14-11(13)10-7-6-9(15-10)5-4-8(2)12/h6-7H,2-5H2,1H3
InChI key:InChIKey=PKJGIPTVLFOFGV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1OC(CCC(=C)Cl)=CC1
Synonyms:
  • Ethyl 5-(3-chloro-3-buten-1-yl)-2-furancarboxylate
  • 2-Furancarboxylic acid, 5-(3-chloro-3-buten-1-yl)-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.