CAS 951886-44-5

Ethyl 5-(3-bromo-3-buten-1-yl)-2-furancarboxylate

Description:

Ethyl 5-(3-bromo-3-buten-1-yl)-2-furancarboxylate is an organic compound characterized by its unique structure, which includes a furan ring and a bromoalkene substituent. The presence of the ethyl ester functional group contributes to its reactivity and solubility in organic solvents. This compound is likely to exhibit moderate polarity due to the furan ring and the ester group, influencing its interactions in various chemical environments. The bromine atom introduces a site for potential nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound may display interesting biological activities, as many furan derivatives are known for their pharmacological properties. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic additions and substitutions, which are common in compounds containing alkenes and heterocycles. Overall, Ethyl 5-(3-bromo-3-buten-1-yl)-2-furancarboxylate is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₁H₁₃BrO₃

InChI: InChI=1S/C11H13BrO3/c1-3-14-11(13)10-7-6-9(15-10)5-4-8(2)12/h6-7H,2-5H2,1H3

InChI key: InChIKey=DAHSUKWEXRMJAY-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC(CCC(Br)=C)=CC1

Synonyms:

• Ethyl 5-(3-bromo-3-buten-1-yl)-2-furancarboxylate
• 2-Furancarboxylic acid, 5-(3-bromo-3-buten-1-yl)-, ethyl ester