CymitQuimica logo

CAS 951886-75-2

:

(3-Fluoro-5-methylphenyl)(2-iodophenyl)methanone

Description:
(3-Fluoro-5-methylphenyl)(2-iodophenyl)methanone, with the CAS number 951886-75-2, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of two aromatic rings: one containing a fluorine atom and a methyl group, and the other containing an iodine atom. The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and overall chemical behavior. The fluorine atom often enhances lipophilicity and can affect the compound's electronic properties, while the iodine atom may impart unique reactivity due to its larger size and lower electronegativity. This compound may be utilized in various applications, including medicinal chemistry and material science, due to its potential biological activity and ability to participate in further chemical reactions. Its synthesis and handling require standard laboratory safety protocols, given the presence of halogens, which can pose health and environmental risks.
Formula:C14H10FIO
InChI:InChI=1S/C14H10FIO/c1-9-6-10(8-11(15)7-9)14(17)12-4-2-3-5-13(12)16/h2-8H,1H3
InChI key:InChIKey=YJOXYVOROLFEAT-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(I)C=CC=C1)C2=CC(C)=CC(F)=C2
Synonyms:
  • Methanone, (3-fluoro-5-methylphenyl)(2-iodophenyl)-
  • (3-Fluoro-5-methylphenyl)(2-iodophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.