CAS 951886-79-6
:(3-Fluoro-5-methylphenyl)(3-iodophenyl)methanone
Description:
(3-Fluoro-5-methylphenyl)(3-iodophenyl)methanone, with the CAS number 951886-79-6, is an organic compound characterized by its unique structure, which includes a ketone functional group attached to two aromatic rings. The presence of a fluorine atom and an iodine atom on the phenyl rings contributes to its chemical reactivity and potential applications in medicinal chemistry and material science. The fluorine atom often enhances lipophilicity and metabolic stability, while the iodine atom can facilitate certain types of chemical reactions, such as nucleophilic substitutions. This compound may exhibit interesting biological activities due to the presence of halogen substituents, which can influence the compound's interaction with biological targets. Additionally, its molecular structure suggests potential uses in the synthesis of more complex organic molecules or as a building block in pharmaceuticals. As with many halogenated compounds, it is essential to handle this substance with care, considering the environmental and health implications associated with halogenated organic compounds.
Formula:C14H10FIO
InChI:InChI=1S/C14H10FIO/c1-9-5-11(7-12(15)6-9)14(17)10-3-2-4-13(16)8-10/h2-8H,1H3
InChI key:InChIKey=YSMJHKRMIXSXAS-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=CC(F)=C1)C2=CC(I)=CC=C2
Synonyms:- (3-Fluoro-5-methylphenyl)(3-iodophenyl)methanone
- Methanone, (3-fluoro-5-methylphenyl)(3-iodophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.