CAS 951886-86-5
:Methanone, (3,4-dichlorophenyl)(4-fluoro-3-methylphenyl)-
Description:
Methanone, (3,4-dichlorophenyl)(4-fluoro-3-methylphenyl)-, also known by its CAS number 951886-86-5, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a methanone moiety bonded to two distinct aromatic rings: one containing dichlorophenyl and the other containing a fluoro and methyl substituent. The presence of halogen atoms, such as chlorine and fluorine, often influences the compound's reactivity, stability, and solubility, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The specific arrangement of substituents can affect the electronic properties and steric hindrance, which in turn can impact biological activity and interactions with other molecules. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the design of molecules with specific functional properties.
Formula:C14H9Cl2FO
InChI:InChI=1S/C14H9Cl2FO/c1-8-6-9(3-5-13(8)17)14(18)10-2-4-11(15)12(16)7-10/h2-7H,1H3
InChI key:InChIKey=HKSZSAWOVPBFFA-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(C)=C(F)C=C1)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 3,4-Dichloro-4′-fluoro-3′-methylbenzophenone
- Methanone, (3,4-dichlorophenyl)(4-fluoro-3-methylphenyl)-
- (3,4-Dichlorophenyl)-(4-fluoro-3-methylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.