CAS 951887-04-0

2-(2-Bromo-2-propen-1-yl)-4-methylpyridine

Description:

2-(2-Bromo-2-propen-1-yl)-4-methylpyridine, with the CAS number 951887-04-0, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a bromoalkene substituent at the 2-position of the pyridine ring, specifically a 2-bromo-2-propenyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a methyl group at the 4-position of the pyridine enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit properties typical of both pyridine derivatives and alkenes, such as nucleophilicity and electrophilicity, making it useful in various chemical reactions, including substitution and addition reactions. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₉H₁₀BrN

InChI: InChI=1S/C9H10BrN/c1-7-3-4-11-9(5-7)6-8(2)10/h3-5H,2,6H2,1H3

InChI key: InChIKey=ZNSBVXQJAAOAIQ-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=CC(C)=CC=N1