CymitQuimica logo

CAS 951887-06-2

:

Methanone, (4-iodophenyl)[4-(1-methylethyl)phenyl]-

Description:
Methanone, (4-iodophenyl)[4-(1-methylethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of the iodine atom on one of the phenyl groups contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The isopropyl group (1-methylethyl) enhances the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems and the carbonyl group, which can affect its behavior in chemical reactions. Additionally, the presence of halogens like iodine often increases the compound's potential for substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. Overall, this compound's structural features suggest potential utility in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research and characterization.
Formula:C16H15IO
InChI:InChI=1S/C16H15IO/c1-11(2)12-3-5-13(6-4-12)16(18)14-7-9-15(17)10-8-14/h3-11H,1-2H3
InChI key:InChIKey=LAOFRFKWAPHIJX-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(C)C)C=C1)C2=CC=C(I)C=C2
Synonyms:
  • (4-Iodophenyl)[4-(propan-2-yl)phenyl]methanone
  • 4-Iodo-4′-isopropylbenzophenone
  • Methanone, (4-iodophenyl)[4-(1-methylethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.