CAS 951887-40-4
:1-(2-Chloro-2-propen-1-yl)naphthalene
Description:
1-(2-Chloro-2-propen-1-yl)naphthalene, with the CAS number 951887-40-4, is an organic compound characterized by the presence of a naphthalene ring substituted with a 2-chloro-2-propen-1-yl group. This compound typically exhibits a hydrophobic nature due to the aromatic naphthalene structure, which contributes to its relatively low solubility in water but higher solubility in organic solvents. The presence of the chloroalkene moiety introduces reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and polymerization processes. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of agrochemicals or pharmaceuticals. Additionally, the compound may exhibit specific physical properties such as a distinct melting point and boiling point, which are influenced by its molecular interactions and structural characteristics. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C13H11Cl
InChI:InChI=1S/C13H11Cl/c1-10(14)9-12-7-4-6-11-5-2-3-8-13(11)12/h2-8H,1,9H2
InChI key:InChIKey=ZGTGDTFTHVTCJB-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- Naphthalene, 1-(2-chloro-2-propen-1-yl)-
- 1-(2-Chloro-2-propen-1-yl)naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.