CAS 951887-43-7

2-(2-Chloro-2-propen-1-yl)naphthalene

Description:

2-(2-Chloro-2-propen-1-yl)naphthalene, identified by its CAS number 951887-43-7, is an organic compound characterized by the presence of a naphthalene ring substituted with a 2-chloro-2-propen-1-yl group. This compound exhibits properties typical of both aromatic and alkenyl compounds, including a relatively high boiling point and moderate solubility in organic solvents. The chlorine atom introduces reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or polymerization processes. The naphthalene moiety contributes to its stability and hydrophobic characteristics, while the vinyl group can participate in addition reactions. Due to its structural features, this compound may be of interest in synthetic organic chemistry, particularly in the development of new materials or pharmaceuticals. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2-(2-Chloro-2-propen-1-yl)naphthalene represents a versatile building block in chemical synthesis.

Formula: C₁₃H₁₁Cl

InChI: InChI=1S/C13H11Cl/c1-10(14)8-11-6-7-12-4-2-3-5-13(12)9-11/h2-7,9H,1,8H2

InChI key: InChIKey=GGDYBDFCBZZOKK-UHFFFAOYSA-N

SMILES: C(C(=C)Cl)C1=CC2=C(C=C1)C=CC=C2