CAS 951887-48-2
:(4-Chlorophenyl)(4-pentylphenyl)methanone
Description:
(4-Chlorophenyl)(4-pentylphenyl)methanone, identified by its CAS number 951887-48-2, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a chlorinated phenyl group and a pentyl-substituted phenyl group, contributing to its unique chemical properties. The presence of the chlorine atom enhances its reactivity and may influence its solubility in various solvents. The pentyl chain adds hydrophobic characteristics, which can affect its interactions in biological systems and its overall stability. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in pharmaceutical and materials science research. Its molecular structure suggests potential applications in organic synthesis and as a building block for more complex molecules. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications and handling guidelines.
Formula:C18H19ClO
InChI:InChI=1S/C18H19ClO/c1-2-3-4-5-14-6-8-15(9-7-14)18(20)16-10-12-17(19)13-11-16/h6-13H,2-5H2,1H3
InChI key:InChIKey=OZIYFESSQUKNLW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(CCCCC)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- (4-Chlorophenyl)(4-pentylphenyl)methanone
- Methanone, (4-chlorophenyl)(4-pentylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.