CAS 951887-65-3
:Methanone, (3,4-difluorophenyl)(4-pentylphenyl)-
Description:
Methanone, (3,4-difluorophenyl)(4-pentylphenyl)-, also known by its CAS number 951887-65-3, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic rings. The structure features a methanone moiety where a 3,4-difluorophenyl group is attached to one side and a 4-pentylphenyl group on the other. The difluorophenyl group introduces electronegative fluorine atoms, which can influence the compound's reactivity and polarity, while the pentyl group contributes to its hydrophobic characteristics. This compound may exhibit interesting properties such as potential applications in materials science or organic synthesis due to its unique structural features. Additionally, the presence of fluorine atoms can enhance the compound's stability and alter its electronic properties, making it a subject of interest in various chemical research fields. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential uses and reactivity.
Formula:C18H18F2O
InChI:InChI=1S/C18H18F2O/c1-2-3-4-5-13-6-8-14(9-7-13)18(21)15-10-11-16(19)17(20)12-15/h6-12H,2-5H2,1H3
InChI key:InChIKey=NZPSXTBCWOGQDT-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(F)C=C1)C2=CC=C(CCCCC)C=C2
Synonyms:- Methanone, (3,4-difluorophenyl)(4-pentylphenyl)-
- 3,4-Difluoro-4′-n-pentylbenzophenone
- (3,4-Difluorophenyl)-(4-pentylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.