CAS 951887-66-4
:2,3-Dihydro-6-(2-methyl-2-propen-1-yl)-1,4-benzodioxin
Description:
2,3-Dihydro-6-(2-methyl-2-propen-1-yl)-1,4-benzodioxin is an organic compound characterized by its unique structure, which includes a benzodioxin core and an allylic substituent. This compound features a fused dioxin ring system, contributing to its potential reactivity and stability. The presence of the 2-methyl-2-propen-1-yl group introduces a degree of unsaturation, which can enhance its reactivity in various chemical reactions, such as electrophilic additions or polymerization processes. The compound is likely to exhibit moderate polarity due to the presence of oxygen atoms in the dioxin moiety, influencing its solubility in organic solvents. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry and materials science. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses. As with many organic compounds, proper handling and safety precautions are essential due to the potential for hazardous properties.
Formula:C12H14O2
InChI:InChI=1S/C12H14O2/c1-9(2)7-10-3-4-11-12(8-10)14-6-5-13-11/h3-4,8H,1,5-7H2,2H3
InChI key:InChIKey=HYGGXCXJRDMHEY-UHFFFAOYSA-N
SMILES:C(C(C)=C)C=1C=C2C(=CC1)OCCO2
Synonyms:- 1,4-Benzodioxin, 2,3-dihydro-6-(2-methyl-2-propen-1-yl)-
- 2,3-Dihydro-6-(2-methyl-2-propen-1-yl)-1,4-benzodioxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.