CAS 951887-82-4

Ethyl 3-(acetyloxy)-α-oxobenzeneacetate

Description:

Ethyl 3-(acetyloxy)-α-oxobenzeneacetate, identified by its CAS number 951887-82-4, is an organic compound characterized by its ester functional groups and aromatic structure. This compound features an ethyl ester moiety, which contributes to its solubility in organic solvents and potential applications in organic synthesis. The presence of the acetyloxy group indicates that it can undergo hydrolysis or other reactions typical of esters, making it a versatile intermediate in chemical reactions. The α-oxobenzeneacetate structure suggests that it may exhibit interesting reactivity due to the carbonyl group, which can participate in nucleophilic addition or condensation reactions. Additionally, the compound may possess biological activity, as many derivatives of aromatic esters are known for their pharmacological properties. Its stability, reactivity, and potential applications in medicinal chemistry or as a synthetic intermediate make it a compound of interest in both academic and industrial research settings. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₂H₁₂O₅

InChI: InChI=1S/C12H12O5/c1-3-16-12(15)11(14)9-5-4-6-10(7-9)17-8(2)13/h4-7H,3H2,1-2H3

InChI key: InChIKey=UZNWHFNKWLNBDC-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(=O)C1=CC(OC(C)=O)=CC=C1

Synonyms:

• Benzeneacetic acid, 3-(acetyloxy)-α-oxo-, ethyl ester
• Ethyl 3-(acetyloxy)-α-oxobenzeneacetate