CAS 951888-22-5

Ethyl 2,5-dichloro-α-oxobenzeneacetate

Description:

Ethyl 2,5-dichloro-α-oxobenzeneacetate, identified by its CAS number 951888-22-5, is an organic compound characterized by its structure, which includes an ethyl ester group, a dichlorobenzene moiety, and an α-oxobenzeneacetate functional group. This compound typically appears as a solid or liquid, depending on its specific formulation and conditions. It is likely to exhibit moderate to high lipophilicity due to the presence of aromatic rings and halogen substituents, which can influence its solubility in organic solvents. The dichloro substituents may impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions or coupling reactions. Additionally, the presence of the α-oxo group suggests potential reactivity in condensation or addition reactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development.

Formula: C₁₀H₈Cl₂O₃

InChI: InChI=1S/C10H8Cl2O3/c1-2-15-10(14)9(13)7-5-6(11)3-4-8(7)12/h3-5H,2H2,1H3

InChI key: InChIKey=OUWSHRVGVNBTAE-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(=O)C1=C(Cl)C=CC(Cl)=C1

Synonyms:

• Benzeneacetic acid, 2,5-dichloro-α-oxo-, ethyl ester
• Ethyl 2,5-dichloro-α-oxobenzeneacetate